C22H43IO3Si — CID 89169961
(Z,5S,8R)-8-(butoxymethyl)-3-iodo-6-methyl-5-triethylsilyloxydec-6-enal (PubChem CID 89169961) has the molecular formula C22H43IO3Si and a molecular weight of 510.57 g/mol. Its IUPAC name is (Z,5S,8R)-8-(butoxymethyl)-3-iodo-6-methyl-5-triethylsilyloxydec-6-enal.
| Compound Name | (Z,5S,8R)-8-(butoxymethyl)-3-iodo-6-methyl-5-triethylsilyloxydec-6-enal |
|---|---|
| PubChem CID | 89169961 |
| Molecular Formula | C22H43IO3Si |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | (Z,5S,8R)-8-(butoxymethyl)-3-iodo-6-methyl-5-triethylsilyloxydec-6-enal |
| SMILES | CCCCOC[C@@H](/C=C(/C)[C@H](CC(I)CC=O)O[Si](CC)(CC)CC)CC |
| InChI | InChI=1S/C22H43IO3Si/c1-7-12-15-25-18-20(8-2)16-19(6)22(17-21(23)13-14-24)26-27(9-3,10-4)11-5/h14,16,20-22H,7-13,15,17-18H2,1-6H3/b19-16-/t20-,21?,22+/m1/s1 |
| InChIKey | JDDACXUQYVQZCB-AGBUXSPJSA-N |
| XLogP | 6.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|