C28H58O4Si2 — CID 11203085
(Z,3R,5S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-6-methyl-8-[tri(propan-2-yl)silyloxymethyl]dec-6-enal (PubChem CID 11203085) has the molecular formula C28H58O4Si2 and a molecular weight of 514.94 g/mol. Its IUPAC name is (Z,3R,5S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-6-methyl-8-[tri(propan-2-yl)silyloxymethyl]dec-6-enal.
| Compound Name | (Z,3R,5S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-6-methyl-8-[tri(propan-2-yl)silyloxymethyl]dec-6-enal |
|---|---|
| PubChem CID | 11203085 |
| Molecular Formula | C28H58O4Si2 |
| Molecular Weight | 514.94 g/mol |
| Exact Mass | 514.39 |
| IUPAC Name | (Z,3R,5S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-6-methyl-8-[tri(propan-2-yl)silyloxymethyl]dec-6-enal |
| SMILES | CC[C@H](/C=C(/C)[C@H](C[C@H](CC=O)OC)O[Si](C)(C)C(C)(C)C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H58O4Si2/c1-15-25(20-31-34(21(2)3,22(4)5)23(6)7)18-24(8)27(19-26(30-12)16-17-29)32-33(13,14)28(9,10)11/h17-18,21-23,25-27H,15-16,19-20H2,1-14H3/b24-18-/t25-,26+,27+/m1/s1 |
| InChIKey | PCGBGABJNHQWOC-YRMNIYFYSA-N |
| XLogP | 8.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.94 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|