C23H50O4Si3 — CID 101395985
(3E,5R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6-triethylsilyloxy-5-trimethylsilyloxyhexanal (PubChem CID 101395985) has the molecular formula C23H50O4Si3 and a molecular weight of 474.91 g/mol. Its IUPAC name is (3E,5R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6-triethylsilyloxy-5-trimethylsilyloxyhexanal.
| Compound Name | (3E,5R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6-triethylsilyloxy-5-trimethylsilyloxyhexanal |
|---|---|
| PubChem CID | 101395985 |
| Molecular Formula | C23H50O4Si3 |
| Molecular Weight | 474.91 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | (3E,5R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6-triethylsilyloxy-5-trimethylsilyloxyhexanal |
| SMILES | CC[Si](CC)(CC)OC[C@@H](C/C(=C\CO[Si](C)(C)C(C)(C)C)CC=O)O[Si](C)(C)C |
| InChI | InChI=1S/C23H50O4Si3/c1-12-30(13-2,14-3)26-20-22(27-28(7,8)9)19-21(15-17-24)16-18-25-29(10,11)23(4,5)6/h16-17,22H,12-15,18-20H2,1-11H3/b21-16-/t22-/m1/s1 |
| InChIKey | ZLFMDSJZFVQZLA-CSMMYAOASA-N |
| XLogP | 7.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.91 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|