C22H46O3Si2 — CID 10916689
(2S,3S,5S)-2,7-dimethyl-3,5-bis(triethylsilyloxy)oct-6-enal (PubChem CID 10916689) has the molecular formula C22H46O3Si2 and a molecular weight of 414.78 g/mol. Its IUPAC name is (2S,3S,5S)-2,7-dimethyl-3,5-bis(triethylsilyloxy)oct-6-enal.
| Compound Name | (2S,3S,5S)-2,7-dimethyl-3,5-bis(triethylsilyloxy)oct-6-enal |
|---|---|
| PubChem CID | 10916689 |
| Molecular Formula | C22H46O3Si2 |
| Molecular Weight | 414.78 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (2S,3S,5S)-2,7-dimethyl-3,5-bis(triethylsilyloxy)oct-6-enal |
| SMILES | CC[Si](CC)(CC)O[C@H](C=C(C)C)C[C@H](O[Si](CC)(CC)CC)[C@H](C)C=O |
| InChI | InChI=1S/C22H46O3Si2/c1-10-26(11-2,12-3)24-21(16-19(7)8)17-22(20(9)18-23)25-27(13-4,14-5)15-6/h16,18,20-22H,10-15,17H2,1-9H3/t20-,21-,22+/m1/s1 |
| InChIKey | ZKLYRTHYVIHZEV-VSKRKVRLSA-N |
| XLogP | 6.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.78 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|