C29H56O4Si2 — CID 11180001
(3S,4S,7E,9E,11R,12R)-3-methoxy-8,12-dimethyl-4,11-bis(triethylsilyloxy)tetradeca-7,9,13-trienal (PubChem CID 11180001) has the molecular formula C29H56O4Si2 and a molecular weight of 524.94 g/mol. Its IUPAC name is (3S,4S,7E,9E,11R,12R)-3-methoxy-8,12-dimethyl-4,11-bis(triethylsilyloxy)tetradeca-7,9,13-trienal.
| Compound Name | (3S,4S,7E,9E,11R,12R)-3-methoxy-8,12-dimethyl-4,11-bis(triethylsilyloxy)tetradeca-7,9,13-trienal |
|---|---|
| PubChem CID | 11180001 |
| Molecular Formula | C29H56O4Si2 |
| Molecular Weight | 524.94 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | (3S,4S,7E,9E,11R,12R)-3-methoxy-8,12-dimethyl-4,11-bis(triethylsilyloxy)tetradeca-7,9,13-trienal |
| SMILES | C=C[C@@H](C)[C@@H](/C=C/C(C)=C/CC[C@H](O[Si](CC)(CC)CC)[C@H](CC=O)OC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C29H56O4Si2/c1-11-26(9)27(32-34(12-2,13-3)14-4)22-21-25(8)19-18-20-29(28(31-10)23-24-30)33-35(15-5,16-6)17-7/h11,19,21-22,24,26-29H,1,12-18,20,23H2,2-10H3/b22-21+,25-19+/t26-,27-,28+,29+/m1/s1 |
| InChIKey | JSVLKKSLVKFOAR-FIDYHAOCSA-N |
| XLogP | 8.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.94 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|