C24H46O5Si — CID 15678266
(2S,4S,5R,6S,7E,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-4,5,10-trimethoxy-2,6,8-trimethyldodeca-7,11-dienal (PubChem CID 15678266) has the molecular formula C24H46O5Si and a molecular weight of 442.71 g/mol. Its IUPAC name is (2S,4S,5R,6S,7E,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-4,5,10-trimethoxy-2,6,8-trimethyldodeca-7,11-dienal.
| Compound Name | (2S,4S,5R,6S,7E,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-4,5,10-trimethoxy-2,6,8-trimethyldodeca-7,11-dienal |
|---|---|
| PubChem CID | 15678266 |
| Molecular Formula | C24H46O5Si |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | (2S,4S,5R,6S,7E,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-4,5,10-trimethoxy-2,6,8-trimethyldodeca-7,11-dienal |
| SMILES | C=C[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](C)[C@@H](OC)[C@H](CC(C)C=O)OC |
| InChI | InChI=1S/C24H46O5Si/c1-13-20(26-8)23(29-30(11,12)24(5,6)7)19(4)15-18(3)22(28-10)21(27-9)14-17(2)16-25/h13,15-18,20-23H,1,14H2,2-12H3/b19-15+/t17?,18-,20-,21-,22+,23-/m0/s1 |
| InChIKey | HOIJJXHSQQAFHJ-YFKVHFSSSA-N |
| XLogP | 5.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|