C25H52O4Si2 — CID 10766847
(E,2R,5S,7S)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methoxy-2,8-dimethyldec-8-enal (PubChem CID 10766847) has the molecular formula C25H52O4Si2 and a molecular weight of 472.86 g/mol. Its IUPAC name is (E,2R,5S,7S)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methoxy-2,8-dimethyldec-8-enal.
| Compound Name | (E,2R,5S,7S)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methoxy-2,8-dimethyldec-8-enal |
|---|---|
| PubChem CID | 10766847 |
| Molecular Formula | C25H52O4Si2 |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | (E,2R,5S,7S)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methoxy-2,8-dimethyldec-8-enal |
| SMILES | CO[C@@H](C[C@H](CC[C@@H](C)C=O)O[Si](C)(C)C(C)(C)C)/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O4Si2/c1-20(19-26)14-15-22(29-31(12,13)25(6,7)8)18-23(27-9)21(2)16-17-28-30(10,11)24(3,4)5/h16,19-20,22-23H,14-15,17-18H2,1-13H3/b21-16+/t20-,22+,23+/m1/s1 |
| InChIKey | ZZOIFLPJKQIZLS-QCOYMAOOSA-N |
| XLogP | 7.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|