C21H38O4Si — CID 10883474
(3R,6S)-6-[(2S,3E,5E)-7-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-methylhepta-3,5-dienyl]-3-methyloxan-2-one (PubChem CID 10883474) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is (3R,6S)-6-[(2S,3E,5E)-7-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-methylhepta-3,5-dienyl]-3-methyloxan-2-one.
| Compound Name | (3R,6S)-6-[(2S,3E,5E)-7-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-methylhepta-3,5-dienyl]-3-methyloxan-2-one |
|---|---|
| PubChem CID | 10883474 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (3R,6S)-6-[(2S,3E,5E)-7-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-methylhepta-3,5-dienyl]-3-methyloxan-2-one |
| SMILES | CO[C@@H](C[C@@H]1CC[C@@H](C)C(=O)O1)/C(C)=C/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O4Si/c1-16(11-9-10-14-24-26(7,8)21(3,4)5)19(23-6)15-18-13-12-17(2)20(22)25-18/h9-11,17-19H,12-15H2,1-8H3/b10-9+,16-11+/t17-,18+,19+/m1/s1 |
| InChIKey | LSLIGYVWEZMWAO-KXIKVLFYSA-N |
| XLogP | 5.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|