C14H21IO3 — CID 134993487
(3R,6S)-6-[(2S,3E,5Z)-6-iodo-2-methoxy-3-methylhexa-3,5-dienyl]-3-methyloxan-2-one (PubChem CID 134993487) has the molecular formula C14H21IO3 and a molecular weight of 364.22 g/mol. Its IUPAC name is (3R,6S)-6-[(2S,3E,5Z)-6-iodo-2-methoxy-3-methylhexa-3,5-dienyl]-3-methyloxan-2-one.
| Compound Name | (3R,6S)-6-[(2S,3E,5Z)-6-iodo-2-methoxy-3-methylhexa-3,5-dienyl]-3-methyloxan-2-one |
|---|---|
| PubChem CID | 134993487 |
| Molecular Formula | C14H21IO3 |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | (3R,6S)-6-[(2S,3E,5Z)-6-iodo-2-methoxy-3-methylhexa-3,5-dienyl]-3-methyloxan-2-one |
| SMILES | CO[C@@H](C[C@@H]1CC[C@@H](C)C(=O)O1)/C(C)=C/C=C\I |
| InChI | InChI=1S/C14H21IO3/c1-10(5-4-8-15)13(17-3)9-12-7-6-11(2)14(16)18-12/h4-5,8,11-13H,6-7,9H2,1-3H3/b8-4-,10-5+/t11-,12+,13+/m1/s1 |
| InChIKey | NSDLVHNCPYOYNA-RJUJTENLSA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|