C34H66O4Si2 — CID 10864902
(2R,4S,5E,7E,9E,11S,13S,16R)-13-[tert-butyl(dimethyl)silyl]oxy-11-methoxy-2,4,10,16-tetramethyl-17-triethylsilyloxyheptadeca-5,7,9-trienal (PubChem CID 10864902) has the molecular formula C34H66O4Si2 and a molecular weight of 595.07 g/mol. Its IUPAC name is (2R,4S,5E,7E,9E,11S,13S,16R)-13-[tert-butyl(dimethyl)silyl]oxy-11-methoxy-2,4,10,16-tetramethyl-17-triethylsilyloxyheptadeca-5,7,9-trienal.
| Compound Name | (2R,4S,5E,7E,9E,11S,13S,16R)-13-[tert-butyl(dimethyl)silyl]oxy-11-methoxy-2,4,10,16-tetramethyl-17-triethylsilyloxyheptadeca-5,7,9-trienal |
|---|---|
| PubChem CID | 10864902 |
| Molecular Formula | C34H66O4Si2 |
| Molecular Weight | 595.07 g/mol |
| Exact Mass | 594.45 |
| IUPAC Name | (2R,4S,5E,7E,9E,11S,13S,16R)-13-[tert-butyl(dimethyl)silyl]oxy-11-methoxy-2,4,10,16-tetramethyl-17-triethylsilyloxyheptadeca-5,7,9-trienal |
| SMILES | CC[Si](CC)(CC)OC[C@H](C)CC[C@@H](C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)CC(C)C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H66O4Si2/c1-14-40(15-2,16-3)37-27-29(5)22-23-32(38-39(12,13)34(8,9)10)25-33(36-11)31(7)21-19-17-18-20-28(4)24-30(6)26-35/h17-21,26,28-30,32-33H,14-16,22-25,27H2,1-13H3/b19-17+,20-18+,31-21+/t28-,29-,30?,32+,33+/m1/s1 |
| InChIKey | QJMODQJEPNHVCK-AGGZICNYSA-N |
| XLogP | 10.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.07 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|