C34H68O5Si2 — CID 102123780
(E,3S)-8-[(4S,5R,6S)-2,2-ditert-butyl-5-methyl-6-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,2-dioxasilinan-4-yl]-5-methoxy-3-methyloct-6-enal (PubChem CID 102123780) has the molecular formula C34H68O5Si2 and a molecular weight of 613.09 g/mol. Its IUPAC name is (E,3S)-8-[(4S,5R,6S)-2,2-ditert-butyl-5-methyl-6-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,2-dioxasilinan-4-yl]-5-methoxy-3-methyloct-6-enal.
| Compound Name | (E,3S)-8-[(4S,5R,6S)-2,2-ditert-butyl-5-methyl-6-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,2-dioxasilinan-4-yl]-5-methoxy-3-methyloct-6-enal |
|---|---|
| PubChem CID | 102123780 |
| Molecular Formula | C34H68O5Si2 |
| Molecular Weight | 613.09 g/mol |
| Exact Mass | 612.46 |
| IUPAC Name | (E,3S)-8-[(4S,5R,6S)-2,2-ditert-butyl-5-methyl-6-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,2-dioxasilinan-4-yl]-5-methoxy-3-methyloct-6-enal |
| SMILES | COC(/C=C/C[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]([C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1C)C[C@H](C)CC=O |
| InChI | InChI=1S/C34H68O5Si2/c1-24(2)40(25(3)4,26(5)6)37-23-28(8)32-29(9)31(19-17-18-30(36-16)22-27(7)20-21-35)38-41(39-32,33(10,11)12)34(13,14)15/h17-18,21,24-32H,19-20,22-23H2,1-16H3/b18-17+/t27-,28+,29-,30?,31+,32+/m1/s1 |
| InChIKey | PVWIECMOBDYEPX-ZGLNNUPLSA-N |
| XLogP | 9.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.09 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|