C31H56O6Si — CID 52937404
[(E,2R)-1-[(2S,5S,6R)-6-[(2R)-2-methoxy-4-oxobutyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate (PubChem CID 52937404) has the molecular formula C31H56O6Si and a molecular weight of 552.87 g/mol. Its IUPAC name is [(E,2R)-1-[(2S,5S,6R)-6-[(2R)-2-methoxy-4-oxobutyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate.
| Compound Name | [(E,2R)-1-[(2S,5S,6R)-6-[(2R)-2-methoxy-4-oxobutyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate |
|---|---|
| PubChem CID | 52937404 |
| Molecular Formula | C31H56O6Si |
| Molecular Weight | 552.87 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | [(E,2R)-1-[(2S,5S,6R)-6-[(2R)-2-methoxy-4-oxobutyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate |
| SMILES | C=CC[C@H](CC(=O)O[C@@H](/C=C/CC(C)C)C[C@@H]1CC[C@H](C)[C@@H](C[C@H](CC=O)OC)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H56O6Si/c1-11-13-28(37-38(9,10)31(5,6)7)22-30(33)36-26(15-12-14-23(2)3)20-27-17-16-24(4)29(35-27)21-25(34-8)18-19-32/h11-12,15,19,23-29H,1,13-14,16-18,20-22H2,2-10H3/b15-12+/t24-,25-,26-,27-,28+,29+/m0/s1 |
| InChIKey | AYKPZOUBKBLXNQ-WPVHLMMBSA-N |
| XLogP | 7.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.87 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|