C39H82O6Si3 — CID 56933601
methyl (E,3S,5R,9S,10R,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,10,12-trimethyl-9-triethylsilyloxy-13-tri(propan-2-yl)silyloxytridec-6-enoate (PubChem CID 56933601) has the molecular formula C39H82O6Si3 and a molecular weight of 731.34 g/mol. Its IUPAC name is methyl (E,3S,5R,9S,10R,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,10,12-trimethyl-9-triethylsilyloxy-13-tri(propan-2-yl)silyloxytridec-6-enoate.
| Compound Name | methyl (E,3S,5R,9S,10R,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,10,12-trimethyl-9-triethylsilyloxy-13-tri(propan-2-yl)silyloxytridec-6-enoate |
|---|---|
| PubChem CID | 56933601 |
| Molecular Formula | C39H82O6Si3 |
| Molecular Weight | 731.34 g/mol |
| Exact Mass | 730.54 |
| IUPAC Name | methyl (E,3S,5R,9S,10R,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,10,12-trimethyl-9-triethylsilyloxy-13-tri(propan-2-yl)silyloxytridec-6-enoate |
| SMILES | CC[Si](CC)(CC)O[C@@H](C/C=C/[C@@H](C[C@H](C)CC(=O)OC)OC)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C39H82O6Si3/c1-20-47(21-2,22-3)44-36(25-23-24-35(41-16)26-32(10)27-37(40)42-17)34(12)38(45-46(18,19)39(13,14)15)33(11)28-43-48(29(4)5,30(6)7)31(8)9/h23-24,29-36,38H,20-22,25-28H2,1-19H3/b24-23+/t32-,33-,34+,35-,36-,38-/m0/s1 |
| InChIKey | KXFZJCKGVBSSNA-BHIOHFCSSA-N |
| XLogP | 11.78 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.34 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|