C25H48O4Si — CID 16726294
(3R)-4-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-3-methoxybutanal (PubChem CID 16726294) has the molecular formula C25H48O4Si and a molecular weight of 440.74 g/mol. Its IUPAC name is (3R)-4-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-3-methoxybutanal.
| Compound Name | (3R)-4-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-3-methoxybutanal |
|---|---|
| PubChem CID | 16726294 |
| Molecular Formula | C25H48O4Si |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | (3R)-4-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-3-methoxybutanal |
| SMILES | CO[C@@H](CC=O)C[C@H]1O[C@H](C[C@H](/C=C/CC(C)C)O[Si](C)(C)C(C)(C)C)CC[C@@H]1C |
| InChI | InChI=1S/C25H48O4Si/c1-19(2)11-10-12-23(29-30(8,9)25(4,5)6)17-22-14-13-20(3)24(28-22)18-21(27-7)15-16-26/h10,12,16,19-24H,11,13-15,17-18H2,1-9H3/b12-10+/t20-,21-,22-,23-,24+/m0/s1 |
| InChIKey | PPLSLUKACCUCOC-CAXCJHEHSA-N |
| XLogP | 6.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|