C38H80O5Si3 — CID 56933720
(E,3S,5R,9S,10R,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,10,12-trimethyl-9-triethylsilyloxy-13-tri(propan-2-yl)silyloxytridec-6-enal (PubChem CID 56933720) has the molecular formula C38H80O5Si3 and a molecular weight of 701.31 g/mol. Its IUPAC name is (E,3S,5R,9S,10R,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,10,12-trimethyl-9-triethylsilyloxy-13-tri(propan-2-yl)silyloxytridec-6-enal.
| Compound Name | (E,3S,5R,9S,10R,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,10,12-trimethyl-9-triethylsilyloxy-13-tri(propan-2-yl)silyloxytridec-6-enal |
|---|---|
| PubChem CID | 56933720 |
| Molecular Formula | C38H80O5Si3 |
| Molecular Weight | 701.31 g/mol |
| Exact Mass | 700.53 |
| IUPAC Name | (E,3S,5R,9S,10R,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-3,10,12-trimethyl-9-triethylsilyloxy-13-tri(propan-2-yl)silyloxytridec-6-enal |
| SMILES | CC[Si](CC)(CC)O[C@@H](C/C=C/[C@@H](C[C@H](C)CC=O)OC)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H80O5Si3/c1-19-45(20-2,21-3)42-36(24-22-23-35(40-16)27-32(10)25-26-39)34(12)37(43-44(17,18)38(13,14)15)33(11)28-41-46(29(4)5,30(6)7)31(8)9/h22-23,26,29-37H,19-21,24-25,27-28H2,1-18H3/b23-22+/t32-,33+,34-,35+,36+,37+/m1/s1 |
| InChIKey | RZVVPLCLMQZDFC-JFJPNMPNSA-N |
| XLogP | 11.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.31 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|