C29H60O4Si2 — CID 42604735
(E,2S,3R,5R,6R,7R,8S)-2-ethyl-7-methoxy-6,8-dimethyl-3,5-bis(triethylsilyloxy)dodec-10-enal (PubChem CID 42604735) has the molecular formula C29H60O4Si2 and a molecular weight of 528.97 g/mol. Its IUPAC name is (E,2S,3R,5R,6R,7R,8S)-2-ethyl-7-methoxy-6,8-dimethyl-3,5-bis(triethylsilyloxy)dodec-10-enal.
| Compound Name | (E,2S,3R,5R,6R,7R,8S)-2-ethyl-7-methoxy-6,8-dimethyl-3,5-bis(triethylsilyloxy)dodec-10-enal |
|---|---|
| PubChem CID | 42604735 |
| Molecular Formula | C29H60O4Si2 |
| Molecular Weight | 528.97 g/mol |
| Exact Mass | 528.40 |
| IUPAC Name | (E,2S,3R,5R,6R,7R,8S)-2-ethyl-7-methoxy-6,8-dimethyl-3,5-bis(triethylsilyloxy)dodec-10-enal |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@@H](C[C@@H](O[Si](CC)(CC)CC)[C@@H](C=O)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C29H60O4Si2/c1-12-20-21-24(9)29(31-11)25(10)27(32-34(14-3,15-4)16-5)22-28(26(13-2)23-30)33-35(17-6,18-7)19-8/h12,20,23-29H,13-19,21-22H2,1-11H3/b20-12+/t24-,25-,26+,27+,28+,29+/m0/s1 |
| InChIKey | HIGRDMHZDYKZJA-AWIBGHKQSA-N |
| XLogP | 8.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.97 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|