C34H70O5SSi2 — CID 52912928
(E,3R,4R,5R,6R,9S,13R)-5,15-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methoxy-4,6,10,13-tetramethyl-3-(methylsulfanylmethoxy)pentadec-10-enal (PubChem CID 52912928) has the molecular formula C34H70O5SSi2 and a molecular weight of 647.17 g/mol. Its IUPAC name is (E,3R,4R,5R,6R,9S,13R)-5,15-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methoxy-4,6,10,13-tetramethyl-3-(methylsulfanylmethoxy)pentadec-10-enal.
| Compound Name | (E,3R,4R,5R,6R,9S,13R)-5,15-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methoxy-4,6,10,13-tetramethyl-3-(methylsulfanylmethoxy)pentadec-10-enal |
|---|---|
| PubChem CID | 52912928 |
| Molecular Formula | C34H70O5SSi2 |
| Molecular Weight | 647.17 g/mol |
| Exact Mass | 646.45 |
| IUPAC Name | (E,3R,4R,5R,6R,9S,13R)-5,15-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methoxy-4,6,10,13-tetramethyl-3-(methylsulfanylmethoxy)pentadec-10-enal |
| SMILES | CO[C@@H](CC[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](CC=O)OCSC)/C(C)=C/C[C@@H](C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H70O5SSi2/c1-26(22-24-38-41(13,14)33(5,6)7)17-18-27(2)30(36-11)20-19-28(3)32(39-42(15,16)34(8,9)10)29(4)31(21-23-35)37-25-40-12/h18,23,26,28-32H,17,19-22,24-25H2,1-16H3/b27-18+/t26-,28-,29-,30+,31-,32-/m1/s1 |
| InChIKey | CDCBFHQTNAGPKR-ASACMPAXSA-N |
| XLogP | 10.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.17 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|