C36H74O7Si3 — CID 16750763
methyl (E,5R,6S,7R,8S,9S)-5,7,13-tris[[tert-butyl(dimethyl)silyl]oxy]-9-methoxy-6,8,11-trimethyl-3-oxotridec-10-enoate (PubChem CID 16750763) has the molecular formula C36H74O7Si3 and a molecular weight of 703.24 g/mol. Its IUPAC name is methyl (E,5R,6S,7R,8S,9S)-5,7,13-tris[[tert-butyl(dimethyl)silyl]oxy]-9-methoxy-6,8,11-trimethyl-3-oxotridec-10-enoate.
| Compound Name | methyl (E,5R,6S,7R,8S,9S)-5,7,13-tris[[tert-butyl(dimethyl)silyl]oxy]-9-methoxy-6,8,11-trimethyl-3-oxotridec-10-enoate |
|---|---|
| PubChem CID | 16750763 |
| Molecular Formula | C36H74O7Si3 |
| Molecular Weight | 703.24 g/mol |
| Exact Mass | 702.47 |
| IUPAC Name | methyl (E,5R,6S,7R,8S,9S)-5,7,13-tris[[tert-butyl(dimethyl)silyl]oxy]-9-methoxy-6,8,11-trimethyl-3-oxotridec-10-enoate |
| SMILES | COC(=O)CC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](/C=C(\C)CCO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C36H74O7Si3/c1-26(21-22-41-44(15,16)34(4,5)6)23-30(39-13)27(2)33(43-46(19,20)36(10,11)12)28(3)31(24-29(37)25-32(38)40-14)42-45(17,18)35(7,8)9/h23,27-28,30-31,33H,21-22,24-25H2,1-20H3/b26-23+/t27-,28-,30-,31+,33+/m0/s1 |
| InChIKey | PEMZDUJBKCIFNP-BKHMSESDSA-N |
| XLogP | 9.93 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.24 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|