C28H50O3Si — CID 10928680
(4E,6E,8S,9S,12E)-13-(methoxymethyl)-8,12-dimethyl-9-tri(propan-2-yl)silyloxycyclopentadeca-4,6,12-trien-1-one (PubChem CID 10928680) has the molecular formula C28H50O3Si and a molecular weight of 462.79 g/mol. Its IUPAC name is (4E,6E,8S,9S,12E)-13-(methoxymethyl)-8,12-dimethyl-9-tri(propan-2-yl)silyloxycyclopentadeca-4,6,12-trien-1-one.
| Compound Name | (4E,6E,8S,9S,12E)-13-(methoxymethyl)-8,12-dimethyl-9-tri(propan-2-yl)silyloxycyclopentadeca-4,6,12-trien-1-one |
|---|---|
| PubChem CID | 10928680 |
| Molecular Formula | C28H50O3Si |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | (4E,6E,8S,9S,12E)-13-(methoxymethyl)-8,12-dimethyl-9-tri(propan-2-yl)silyloxycyclopentadeca-4,6,12-trien-1-one |
| SMILES | COC/C1=C(\C)CC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)/C=C/C=C/CCC(=O)CC1 |
| InChI | InChI=1S/C28H50O3Si/c1-21(2)32(22(3)4,23(5)6)31-28-19-16-24(7)26(20-30-9)17-18-27(29)15-13-11-10-12-14-25(28)8/h10-12,14,21-23,25,28H,13,15-20H2,1-9H3/b11-10+,14-12+,26-24+/t25-,28-/m0/s1 |
| InChIKey | NAEJDXTWWIKXRG-NOWGKHAWSA-N |
| XLogP | 8.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|