C27H48O3Si — CID 10599607
(4Z,6E,8S,9S,12E)-13-(hydroxymethyl)-8,12-dimethyl-9-tri(propan-2-yl)silyloxycyclopentadeca-4,6,12-trien-1-one (PubChem CID 10599607) has the molecular formula C27H48O3Si and a molecular weight of 448.76 g/mol. Its IUPAC name is (4Z,6E,8S,9S,12E)-13-(hydroxymethyl)-8,12-dimethyl-9-tri(propan-2-yl)silyloxycyclopentadeca-4,6,12-trien-1-one.
| Compound Name | (4Z,6E,8S,9S,12E)-13-(hydroxymethyl)-8,12-dimethyl-9-tri(propan-2-yl)silyloxycyclopentadeca-4,6,12-trien-1-one |
|---|---|
| PubChem CID | 10599607 |
| Molecular Formula | C27H48O3Si |
| Molecular Weight | 448.76 g/mol |
| Exact Mass | 448.34 |
| IUPAC Name | (4Z,6E,8S,9S,12E)-13-(hydroxymethyl)-8,12-dimethyl-9-tri(propan-2-yl)silyloxycyclopentadeca-4,6,12-trien-1-one |
| SMILES | C/C1=C(\CO)CCC(=O)CC/C=C\C=C\[C@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)CC1 |
| InChI | InChI=1S/C27H48O3Si/c1-20(2)31(21(3)4,22(5)6)30-27-18-15-23(7)25(19-28)16-17-26(29)14-12-10-9-11-13-24(27)8/h9-11,13,20-22,24,27-28H,12,14-19H2,1-8H3/b10-9-,13-11+,25-23+/t24-,27-/m0/s1 |
| InChIKey | OATDAVKITACACW-WWFYWTQNSA-N |
| XLogP | 7.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.76 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|