C23H46O3Si — CID 11188731
(E,3S,4R,6R,7S,10R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6,8,10-tetramethyltridec-8-en-5-one (PubChem CID 11188731) has the molecular formula C23H46O3Si and a molecular weight of 398.70 g/mol. Its IUPAC name is (E,3S,4R,6R,7S,10R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6,8,10-tetramethyltridec-8-en-5-one.
| Compound Name | (E,3S,4R,6R,7S,10R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6,8,10-tetramethyltridec-8-en-5-one |
|---|---|
| PubChem CID | 11188731 |
| Molecular Formula | C23H46O3Si |
| Molecular Weight | 398.70 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | (E,3S,4R,6R,7S,10R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6,8,10-tetramethyltridec-8-en-5-one |
| SMILES | CCC[C@@H](C)/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)[C@H](C)[C@@H](O)CC |
| InChI | InChI=1S/C23H46O3Si/c1-12-14-16(3)15-17(4)22(26-27(10,11)23(7,8)9)19(6)21(25)18(5)20(24)13-2/h15-16,18-20,22,24H,12-14H2,1-11H3/b17-15+/t16-,18-,19+,20+,22-/m1/s1 |
| InChIKey | JDLQCJGIBWHOPU-JTALBGIHSA-N |
| XLogP | 6.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.70 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|