C20H38O3Si — CID 11703131
(2R,4S,8E,10E)-7-hydroxy-2,4-dimethyl-1-triethylsilyloxydodeca-8,10-dien-5-one (PubChem CID 11703131) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is (2R,4S,8E,10E)-7-hydroxy-2,4-dimethyl-1-triethylsilyloxydodeca-8,10-dien-5-one.
| Compound Name | (2R,4S,8E,10E)-7-hydroxy-2,4-dimethyl-1-triethylsilyloxydodeca-8,10-dien-5-one |
|---|---|
| PubChem CID | 11703131 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (2R,4S,8E,10E)-7-hydroxy-2,4-dimethyl-1-triethylsilyloxydodeca-8,10-dien-5-one |
| SMILES | C/C=C/C=C/C(O)CC(=O)[C@@H](C)C[C@@H](C)CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H38O3Si/c1-7-11-12-13-19(21)15-20(22)18(6)14-17(5)16-23-24(8-2,9-3)10-4/h7,11-13,17-19,21H,8-10,14-16H2,1-6H3/b11-7+,13-12+/t17-,18+,19?/m1/s1 |
| InChIKey | CDLXYDSFMLDIMN-GUNDJPJMSA-N |
| XLogP | 5.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|