C19H36O3Si — CID 135020379
4-[4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-4-hydroxybutan-2-one (PubChem CID 135020379) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is 4-[4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-4-hydroxybutan-2-one.
| Compound Name | 4-[4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-4-hydroxybutan-2-one |
|---|---|
| PubChem CID | 135020379 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 4-[4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-4-hydroxybutan-2-one |
| SMILES | CC(=O)CC(O)C1=C(C)CC(O[Si](C)(C)C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-13-10-15(22-23(8,9)18(3,4)5)12-19(6,7)17(13)16(21)11-14(2)20/h15-16,21H,10-12H2,1-9H3 |
| InChIKey | FRZNUNFUWYQZBQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|