C17H32O3Si — CID 11232220
3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one (PubChem CID 11232220) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11232220 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=C(CCO[Si](C)(C)C(C)(C)C)C(C)(C)CC(O)C1=O |
| InChI | InChI=1S/C17H32O3Si/c1-12-13(17(5,6)11-14(18)15(12)19)9-10-20-21(7,8)16(2,3)4/h14,18H,9-11H2,1-8H3 |
| InChIKey | KKONFAMOLYNEEA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|