C16H32O2Si — CID 10541081
[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]methanol (PubChem CID 10541081) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is [(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]methanol.
| Compound Name | [(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]methanol |
|---|---|
| PubChem CID | 10541081 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | [(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]methanol |
| SMILES | CC1=C(CO)C(C)(C)C[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C16H32O2Si/c1-12-9-13(10-16(5,6)14(12)11-17)18-19(7,8)15(2,3)4/h13,17H,9-11H2,1-8H3/t13-/m1/s1 |
| InChIKey | FPEHVLBHYQJKMO-CYBMUJFWSA-N |
| XLogP | 4.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|