C19H34O2Si — CID 5377689
(8E)-8-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-1,2,3,4,5,7-hexahydrocyclopenta[8]annulen-4-ol (PubChem CID 5377689) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is (8E)-8-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-1,2,3,4,5,7-hexahydrocyclopenta[8]annulen-4-ol.
| Compound Name | (8E)-8-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-1,2,3,4,5,7-hexahydrocyclopenta[8]annulen-4-ol |
|---|---|
| PubChem CID | 5377689 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (8E)-8-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-1,2,3,4,5,7-hexahydrocyclopenta[8]annulen-4-ol |
| SMILES | CC1(C)C/C(O[Si](C)(C)C(C)(C)C)=C\C2=C(CCC2)C(O)C1 |
| InChI | InChI=1S/C19H34O2Si/c1-18(2,3)22(6,7)21-15-11-14-9-8-10-16(14)17(20)13-19(4,5)12-15/h11,17,20H,8-10,12-13H2,1-7H3/b15-11+ |
| InChIKey | FHFSNDKCOWHBIE-RVDMUPIBSA-N |
| XLogP | 5.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|