C18H32O2Si — CID 71475274
(1E,5R,7aS)-1-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-7a-methyl-3,5,6,7-tetrahydro-2H-inden-5-ol (PubChem CID 71475274) has the molecular formula C18H32O2Si and a molecular weight of 308.54 g/mol. Its IUPAC name is (1E,5R,7aS)-1-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-7a-methyl-3,5,6,7-tetrahydro-2H-inden-5-ol.
| Compound Name | (1E,5R,7aS)-1-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-7a-methyl-3,5,6,7-tetrahydro-2H-inden-5-ol |
|---|---|
| PubChem CID | 71475274 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | (1E,5R,7aS)-1-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-7a-methyl-3,5,6,7-tetrahydro-2H-inden-5-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C1\CCC2=C[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C18H32O2Si/c1-17(2,3)21(5,6)20-12-10-14-7-8-15-13-16(19)9-11-18(14,15)4/h10,13,16,19H,7-9,11-12H2,1-6H3/b14-10+/t16-,18+/m1/s1 |
| InChIKey | ZQRZEPJGSUTTKQ-NQKFPNJCSA-N |
| XLogP | 4.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|