C23H44O2Si2 — CID 134983644
[(3aR)-6-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-3-methylidene-2,4,5,6-tetrahydro-1H-inden-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134983644) has the molecular formula C23H44O2Si2 and a molecular weight of 408.78 g/mol. Its IUPAC name is [(3aR)-6-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-3-methylidene-2,4,5,6-tetrahydro-1H-inden-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR)-6-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-3-methylidene-2,4,5,6-tetrahydro-1H-inden-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134983644 |
| Molecular Formula | C23H44O2Si2 |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | [(3aR)-6-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-3-methylidene-2,4,5,6-tetrahydro-1H-inden-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C1CCC2=CC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C[C@]12C |
| InChI | InChI=1S/C23H44O2Si2/c1-17-13-14-18-15-19(24-26(9,10)21(2,3)4)20(16-23(17,18)8)25-27(11,12)22(5,6)7/h15,19-20H,1,13-14,16H2,2-12H3/t19?,20?,23-/m1/s1 |
| InChIKey | XKZAYVZRKSQRDX-YABDQXBESA-N |
| XLogP | 7.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|