C29H62O3Si3 — CID 10697775
[(E,1R,2S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-cyclohexylpent-3-enoxy]-tert-butyl-dimethylsilane (PubChem CID 10697775) has the molecular formula C29H62O3Si3 and a molecular weight of 543.07 g/mol. Its IUPAC name is [(E,1R,2S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-cyclohexylpent-3-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E,1R,2S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-cyclohexylpent-3-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10697775 |
| Molecular Formula | C29H62O3Si3 |
| Molecular Weight | 543.07 g/mol |
| Exact Mass | 542.40 |
| IUPAC Name | [(E,1R,2S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-cyclohexylpent-3-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C29H62O3Si3/c1-27(2,3)33(10,11)30-23-19-22-25(31-34(12,13)28(4,5)6)26(24-20-17-16-18-21-24)32-35(14,15)29(7,8)9/h19,22,24-26H,16-18,20-21,23H2,1-15H3/b22-19+/t25-,26+/m0/s1 |
| InChIKey | XSVXFPYIUQYWQZ-KJUDGROPSA-N |
| XLogP | 9.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.07 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|