C24H46O2Si2 — CID 134983004
[(4aS)-3-[tert-butyl(dimethyl)silyl]oxy-4a-ethenyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134983004) has the molecular formula C24H46O2Si2 and a molecular weight of 422.80 g/mol. Its IUPAC name is [(4aS)-3-[tert-butyl(dimethyl)silyl]oxy-4a-ethenyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aS)-3-[tert-butyl(dimethyl)silyl]oxy-4a-ethenyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134983004 |
| Molecular Formula | C24H46O2Si2 |
| Molecular Weight | 422.80 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | [(4aS)-3-[tert-butyl(dimethyl)silyl]oxy-4a-ethenyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@@]12CCCCC1=CC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C24H46O2Si2/c1-12-24-16-14-13-15-19(24)17-20(25-27(8,9)22(2,3)4)21(18-24)26-28(10,11)23(5,6)7/h12,17,20-21H,1,13-16,18H2,2-11H3/t20?,21?,24-/m0/s1 |
| InChIKey | VHFLGQKYEQBQKR-VUNKPPBISA-N |
| XLogP | 7.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.80 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|