C22H44O2Si2 — CID 10596925
tert-butyl-dimethyl-[(1R,2R)-2-methyl-2-(4-methylpent-3-enyl)-4-trimethylsilyloxycyclohex-3-en-1-yl]oxysilane (PubChem CID 10596925) has the molecular formula C22H44O2Si2 and a molecular weight of 396.76 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,2R)-2-methyl-2-(4-methylpent-3-enyl)-4-trimethylsilyloxycyclohex-3-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,2R)-2-methyl-2-(4-methylpent-3-enyl)-4-trimethylsilyloxycyclohex-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 10596925 |
| Molecular Formula | C22H44O2Si2 |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,2R)-2-methyl-2-(4-methylpent-3-enyl)-4-trimethylsilyloxycyclohex-3-en-1-yl]oxysilane |
| SMILES | CC(C)=CCC[C@]1(C)C=C(O[Si](C)(C)C)CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O2Si2/c1-18(2)13-12-16-22(6)17-19(23-25(7,8)9)14-15-20(22)24-26(10,11)21(3,4)5/h13,17,20H,12,14-16H2,1-11H3/t20-,22-/m1/s1 |
| InChIKey | CAVBTCWYTWTNKV-IFMALSPDSA-N |
| XLogP | 7.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|