C18H36O2Si2 — CID 14951420
tert-butyl-[(1S,2S)-2-ethenyl-2-methyl-4-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane (PubChem CID 14951420) has the molecular formula C18H36O2Si2 and a molecular weight of 340.66 g/mol. Its IUPAC name is tert-butyl-[(1S,2S)-2-ethenyl-2-methyl-4-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2S)-2-ethenyl-2-methyl-4-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 14951420 |
| Molecular Formula | C18H36O2Si2 |
| Molecular Weight | 340.66 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | tert-butyl-[(1S,2S)-2-ethenyl-2-methyl-4-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@]1(C)C=C(O[Si](C)(C)C)CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O2Si2/c1-11-18(5)14-15(19-21(6,7)8)12-13-16(18)20-22(9,10)17(2,3)4/h11,14,16H,1,12-13H2,2-10H3/t16-,18-/m0/s1 |
| InChIKey | BGEJEWOHSCKTNU-WMZOPIPTSA-N |
| XLogP | 6.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.66 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|