C20H38O3Si2 — CID 53260831
tert-butyl-[(1S,5Z,6S)-6-ethenyl-5-(methoxymethylidene)-6-methyl-4-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane (PubChem CID 53260831) has the molecular formula C20H38O3Si2 and a molecular weight of 382.69 g/mol. Its IUPAC name is tert-butyl-[(1S,5Z,6S)-6-ethenyl-5-(methoxymethylidene)-6-methyl-4-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,5Z,6S)-6-ethenyl-5-(methoxymethylidene)-6-methyl-4-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 53260831 |
| Molecular Formula | C20H38O3Si2 |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | tert-butyl-[(1S,5Z,6S)-6-ethenyl-5-(methoxymethylidene)-6-methyl-4-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@]1(C)/C(=C/OC)C(O[Si](C)(C)C)=CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O3Si2/c1-12-20(5)16(15-21-6)17(22-24(7,8)9)13-14-18(20)23-25(10,11)19(2,3)4/h12-13,15,18H,1,14H2,2-11H3/b16-15+/t18-,20-/m0/s1 |
| InChIKey | NUFBBHZBYHOCDP-MEZSYIQSSA-N |
| XLogP | 6.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|