C29H48O2Si — CID 135070283
[(2S,3E,7E,11S)-13-methoxy-4,8,11-trimethyl-15-methylidene-2-bicyclo[9.3.1]pentadeca-1(14),3,7,12-tetraenyl]oxy-tri(propan-2-yl)silane (PubChem CID 135070283) has the molecular formula C29H48O2Si and a molecular weight of 456.79 g/mol. Its IUPAC name is [(2S,3E,7E,11S)-13-methoxy-4,8,11-trimethyl-15-methylidene-2-bicyclo[9.3.1]pentadeca-1(14),3,7,12-tetraenyl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(2S,3E,7E,11S)-13-methoxy-4,8,11-trimethyl-15-methylidene-2-bicyclo[9.3.1]pentadeca-1(14),3,7,12-tetraenyl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 135070283 |
| Molecular Formula | C29H48O2Si |
| Molecular Weight | 456.79 g/mol |
| Exact Mass | 456.34 |
| IUPAC Name | [(2S,3E,7E,11S)-13-methoxy-4,8,11-trimethyl-15-methylidene-2-bicyclo[9.3.1]pentadeca-1(14),3,7,12-tetraenyl]oxy-tri(propan-2-yl)silane |
| SMILES | C=C1C2=CC(OC)=C[C@]1(C)CC/C(C)=C/CC/C(C)=C/[C@@H]2O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H48O2Si/c1-20(2)32(21(3)4,22(5)6)31-28-17-24(8)14-12-13-23(7)15-16-29(10)19-26(30-11)18-27(28)25(29)9/h13,17-22,28H,9,12,14-16H2,1-8,10-11H3/b23-13+,24-17+/t28-,29-/m0/s1 |
| InChIKey | MOPFDBGRNTYWFU-YVOTXWQGSA-N |
| XLogP | 9.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.79 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|