C23H40O2Si — CID 25227989
[5,5-bis(but-3-enyl)-3-methoxycyclopenta-1,3-dien-1-yl]oxy-tri(propan-2-yl)silane (PubChem CID 25227989) has the molecular formula C23H40O2Si and a molecular weight of 376.66 g/mol. Its IUPAC name is [5,5-bis(but-3-enyl)-3-methoxycyclopenta-1,3-dien-1-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [5,5-bis(but-3-enyl)-3-methoxycyclopenta-1,3-dien-1-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 25227989 |
| Molecular Formula | C23H40O2Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | [5,5-bis(but-3-enyl)-3-methoxycyclopenta-1,3-dien-1-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C=CCCC1(CCC=C)C=C(OC)C=C1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H40O2Si/c1-10-12-14-23(15-13-11-2)17-21(24-9)16-22(23)25-26(18(3)4,19(5)6)20(7)8/h10-11,16-20H,1-2,12-15H2,3-9H3 |
| InChIKey | SXRKGDYPKYXSNN-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|