C17H34OSi2 — CID 5376002
trimethyl-[3,5,5-trimethyl-3-[(E)-2-trimethylsilylethenyl]cyclohexen-1-yl]oxysilane (PubChem CID 5376002) has the molecular formula C17H34OSi2 and a molecular weight of 310.63 g/mol. Its IUPAC name is trimethyl-[3,5,5-trimethyl-3-[(E)-2-trimethylsilylethenyl]cyclohexen-1-yl]oxysilane.
| Compound Name | trimethyl-[3,5,5-trimethyl-3-[(E)-2-trimethylsilylethenyl]cyclohexen-1-yl]oxysilane |
|---|---|
| PubChem CID | 5376002 |
| Molecular Formula | C17H34OSi2 |
| Molecular Weight | 310.63 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | trimethyl-[3,5,5-trimethyl-3-[(E)-2-trimethylsilylethenyl]cyclohexen-1-yl]oxysilane |
| SMILES | CC1(/C=C/[Si](C)(C)C)C=C(O[Si](C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H34OSi2/c1-16(2)12-15(18-20(7,8)9)13-17(3,14-16)10-11-19(4,5)6/h10-11,13H,12,14H2,1-9H3/b11-10+ |
| InChIKey | GMWBFSZTESTQHQ-ZHACJKMWSA-N |
| XLogP | 5.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|