C17H32O2Si — CID 164671237
(E,1R)-1-[(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]but-2-en-1-ol (PubChem CID 164671237) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is (E,1R)-1-[(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]but-2-en-1-ol.
| Compound Name | (E,1R)-1-[(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 164671237 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (E,1R)-1-[(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]but-2-en-1-ol |
| SMILES | C/C=C/[C@@H](O)[C@H]1CCCC=C1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-7-10-16(18)15-12-9-8-11-14(15)13-19-20(5,6)17(2,3)4/h7,10-11,15-16,18H,8-9,12-13H2,1-6H3/b10-7+/t15-,16+/m0/s1 |
| InChIKey | RJXKPBNAPAICQG-UIOUNXJESA-N |
| XLogP | 4.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|