C19H36O3Si — CID 11405088
(4aS,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4a-(3-hydroxypropyl)-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol (PubChem CID 11405088) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is (4aS,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4a-(3-hydroxypropyl)-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (4aS,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4a-(3-hydroxypropyl)-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 11405088 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (4aS,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4a-(3-hydroxypropyl)-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCC2=CC(O)CC[C@@]21CCCO |
| InChI | InChI=1S/C19H36O3Si/c1-18(2,3)23(4,5)22-17-9-6-8-15-14-16(21)10-12-19(15,17)11-7-13-20/h14,16-17,20-21H,6-13H2,1-5H3/t16?,17-,19-/m0/s1 |
| InChIKey | GKKPNWCGQLYFDI-SJQFFEKCSA-N |
| XLogP | 4.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|