C17H29F3O2Si — CID 10760343
(1S,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-ol (PubChem CID 10760343) has the molecular formula C17H29F3O2Si and a molecular weight of 350.50 g/mol. Its IUPAC name is (1S,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-ol.
| Compound Name | (1S,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-ol |
|---|---|
| PubChem CID | 10760343 |
| Molecular Formula | C17H29F3O2Si |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (1S,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C2CCC[C@H](O)[C@@]2(C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H29F3O2Si/c1-15(2,3)23(4,5)22-13-9-10-16(17(18,19)20)12(11-13)7-6-8-14(16)21/h11,13-14,21H,6-10H2,1-5H3/t13-,14-,16+/m0/s1 |
| InChIKey | HHQZJZWKPKYKBW-OFQRWUPVSA-N |
| XLogP | 5.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|