C22H37F3O2Si2 — CID 10623277
(1S,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8a-(trifluoromethyl)-1-(2-trimethylsilylethynyl)-2,3,4,6,7,8-hexahydronaphthalen-1-ol (PubChem CID 10623277) has the molecular formula C22H37F3O2Si2 and a molecular weight of 446.70 g/mol. Its IUPAC name is (1S,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8a-(trifluoromethyl)-1-(2-trimethylsilylethynyl)-2,3,4,6,7,8-hexahydronaphthalen-1-ol.
| Compound Name | (1S,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8a-(trifluoromethyl)-1-(2-trimethylsilylethynyl)-2,3,4,6,7,8-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 10623277 |
| Molecular Formula | C22H37F3O2Si2 |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (1S,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8a-(trifluoromethyl)-1-(2-trimethylsilylethynyl)-2,3,4,6,7,8-hexahydronaphthalen-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C2CCC[C@@](O)(C#C[Si](C)(C)C)[C@@]2(C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H37F3O2Si2/c1-19(2,3)29(7,8)27-18-11-13-21(22(23,24)25)17(16-18)10-9-12-20(21,26)14-15-28(4,5)6/h16,18,26H,9-13H2,1-8H3/t18-,20+,21+/m0/s1 |
| InChIKey | QJCJHUHCAULNOY-CEWLAPEOSA-N |
| XLogP | 6.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|