C22H35F3O2Si2 — CID 10789472
(1S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8a-(trifluoromethyl)-1-(2-trimethylsilylethynyl)-2,3,4,8-tetrahydronaphthalen-1-ol (PubChem CID 10789472) has the molecular formula C22H35F3O2Si2 and a molecular weight of 444.69 g/mol. Its IUPAC name is (1S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8a-(trifluoromethyl)-1-(2-trimethylsilylethynyl)-2,3,4,8-tetrahydronaphthalen-1-ol.
| Compound Name | (1S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8a-(trifluoromethyl)-1-(2-trimethylsilylethynyl)-2,3,4,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 10789472 |
| Molecular Formula | C22H35F3O2Si2 |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (1S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8a-(trifluoromethyl)-1-(2-trimethylsilylethynyl)-2,3,4,8-tetrahydronaphthalen-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C(F)(F)F)C(=C1)CCC[C@@]2(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C22H35F3O2Si2/c1-19(2,3)29(7,8)27-18-11-13-21(22(23,24)25)17(16-18)10-9-12-20(21,26)14-15-28(4,5)6/h11,16,26H,9-10,12-13H2,1-8H3/t20-,21-/m1/s1 |
| InChIKey | JCVKVOWKFYKGFJ-NHCUHLMSSA-N |
| XLogP | 6.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|