C11H15F3O2 — CID 10609832
(1S,6S,8aR)-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-naphthalene-1,6-diol (PubChem CID 10609832) has the molecular formula C11H15F3O2 and a molecular weight of 236.23 g/mol. Its IUPAC name is (1S,6S,8aR)-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-naphthalene-1,6-diol.
| Compound Name | (1S,6S,8aR)-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-naphthalene-1,6-diol |
|---|---|
| PubChem CID | 10609832 |
| Molecular Formula | C11H15F3O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (1S,6S,8aR)-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-naphthalene-1,6-diol |
| SMILES | O[C@@H]1C=C2CCC[C@H](O)[C@@]2(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H15F3O2/c12-11(13,14)10-5-4-8(15)6-7(10)2-1-3-9(10)16/h6,8-9,15-16H,1-5H2/t8-,9-,10+/m0/s1 |
| InChIKey | ZJRSYMDPVOREKZ-LPEHRKFASA-N |
| XLogP | 2.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|