C25H50O4Si2 — CID 102023845
(8aS)-8-[tert-butyl(dimethyl)silyl]oxy-8a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3,5,6,7,8-hexahydro-1H-naphthalene-2,3-diol (PubChem CID 102023845) has the molecular formula C25H50O4Si2 and a molecular weight of 470.84 g/mol. Its IUPAC name is (8aS)-8-[tert-butyl(dimethyl)silyl]oxy-8a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3,5,6,7,8-hexahydro-1H-naphthalene-2,3-diol.
| Compound Name | (8aS)-8-[tert-butyl(dimethyl)silyl]oxy-8a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3,5,6,7,8-hexahydro-1H-naphthalene-2,3-diol |
|---|---|
| PubChem CID | 102023845 |
| Molecular Formula | C25H50O4Si2 |
| Molecular Weight | 470.84 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | (8aS)-8-[tert-butyl(dimethyl)silyl]oxy-8a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3,5,6,7,8-hexahydro-1H-naphthalene-2,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@]12CC(O)C(O)C=C1CCCC2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O4Si2/c1-23(2,3)30(7,8)28-16-12-15-25-18-21(27)20(26)17-19(25)13-11-14-22(25)29-31(9,10)24(4,5)6/h17,20-22,26-27H,11-16,18H2,1-10H3/t20?,21?,22?,25-/m0/s1 |
| InChIKey | PJGMRKFUIWHQHQ-DJYNTIJESA-N |
| XLogP | 6.40 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.84 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|