C19H38O3Si — CID 10882440
(E,5R,6S,7R)-7-[diethyl(propan-2-yl)silyl]oxy-5-hydroxy-2,6-dimethyldec-8-en-3-one (PubChem CID 10882440) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is (E,5R,6S,7R)-7-[diethyl(propan-2-yl)silyl]oxy-5-hydroxy-2,6-dimethyldec-8-en-3-one.
| Compound Name | (E,5R,6S,7R)-7-[diethyl(propan-2-yl)silyl]oxy-5-hydroxy-2,6-dimethyldec-8-en-3-one |
|---|---|
| PubChem CID | 10882440 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (E,5R,6S,7R)-7-[diethyl(propan-2-yl)silyl]oxy-5-hydroxy-2,6-dimethyldec-8-en-3-one |
| SMILES | C/C=C/[C@@H](O[Si](CC)(CC)C(C)C)[C@@H](C)[C@H](O)CC(=O)C(C)C |
| InChI | InChI=1S/C19H38O3Si/c1-9-12-19(22-23(10-2,11-3)15(6)7)16(8)18(21)13-17(20)14(4)5/h9,12,14-16,18-19,21H,10-11,13H2,1-8H3/b12-9+/t16-,18+,19+/m0/s1 |
| InChIKey | BPRMUNBBXYVZOS-PEBYCBLQSA-N |
| XLogP | 4.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|