C36H70O5Si2 — CID 11135981
(3R,5S,6E,8E,10E,12S,14S,17R)-14-[tert-butyl(dimethyl)silyl]oxy-1,12-dimethoxy-3,5,11,17-tetramethyl-18-triethylsilyloxyoctadeca-6,8,10-trien-2-one (PubChem CID 11135981) has the molecular formula C36H70O5Si2 and a molecular weight of 639.12 g/mol. Its IUPAC name is (3R,5S,6E,8E,10E,12S,14S,17R)-14-[tert-butyl(dimethyl)silyl]oxy-1,12-dimethoxy-3,5,11,17-tetramethyl-18-triethylsilyloxyoctadeca-6,8,10-trien-2-one.
| Compound Name | (3R,5S,6E,8E,10E,12S,14S,17R)-14-[tert-butyl(dimethyl)silyl]oxy-1,12-dimethoxy-3,5,11,17-tetramethyl-18-triethylsilyloxyoctadeca-6,8,10-trien-2-one |
|---|---|
| PubChem CID | 11135981 |
| Molecular Formula | C36H70O5Si2 |
| Molecular Weight | 639.12 g/mol |
| Exact Mass | 638.48 |
| IUPAC Name | (3R,5S,6E,8E,10E,12S,14S,17R)-14-[tert-butyl(dimethyl)silyl]oxy-1,12-dimethoxy-3,5,11,17-tetramethyl-18-triethylsilyloxyoctadeca-6,8,10-trien-2-one |
| SMILES | CC[Si](CC)(CC)OC[C@H](C)CC[C@@H](C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)COC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H70O5Si2/c1-15-43(16-2,17-3)40-27-30(5)23-24-33(41-42(13,14)36(8,9)10)26-35(39-12)31(6)22-20-18-19-21-29(4)25-32(7)34(37)28-38-11/h18-22,29-30,32-33,35H,15-17,23-28H2,1-14H3/b20-18+,21-19+,31-22+/t29-,30-,32-,33+,35+/m1/s1 |
| InChIKey | JPGIHADTZFLEFC-WGMDOEPOSA-N |
| XLogP | 10.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.12 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|