C25H52O5Si2 — CID 10791186
(E,2R,5S,7S)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methoxy-2,8-dimethyldec-8-enoic acid (PubChem CID 10791186) has the molecular formula C25H52O5Si2 and a molecular weight of 488.86 g/mol. Its IUPAC name is (E,2R,5S,7S)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methoxy-2,8-dimethyldec-8-enoic acid.
| Compound Name | (E,2R,5S,7S)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methoxy-2,8-dimethyldec-8-enoic acid |
|---|---|
| PubChem CID | 10791186 |
| Molecular Formula | C25H52O5Si2 |
| Molecular Weight | 488.86 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | (E,2R,5S,7S)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methoxy-2,8-dimethyldec-8-enoic acid |
| SMILES | CO[C@@H](C[C@H](CC[C@@H](C)C(=O)O)O[Si](C)(C)C(C)(C)C)/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O5Si2/c1-19(16-17-29-31(10,11)24(3,4)5)22(28-9)18-21(15-14-20(2)23(26)27)30-32(12,13)25(6,7)8/h16,20-22H,14-15,17-18H2,1-13H3,(H,26,27)/b19-16+/t20-,21+,22+/m1/s1 |
| InChIKey | YNFDTCLTBJFXCQ-OSOZDUDHSA-N |
| XLogP | 7.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.86 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|