C19H38O5Si — CID 90688188
3-[tert-butyl(dimethyl)silyl]oxy-7,7-dihydroxy-2,4,9-trimethyldec-8-enoic acid (PubChem CID 90688188) has the molecular formula C19H38O5Si and a molecular weight of 374.59 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-7,7-dihydroxy-2,4,9-trimethyldec-8-enoic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-7,7-dihydroxy-2,4,9-trimethyldec-8-enoic acid |
|---|---|
| PubChem CID | 90688188 |
| Molecular Formula | C19H38O5Si |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-7,7-dihydroxy-2,4,9-trimethyldec-8-enoic acid |
| SMILES | CC(C)=CC(O)(O)CCC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(=O)O |
| InChI | InChI=1S/C19H38O5Si/c1-13(2)12-19(22,23)11-10-14(3)16(15(4)17(20)21)24-25(8,9)18(5,6)7/h12,14-16,22-23H,10-11H2,1-9H3,(H,20,21) |
| InChIKey | VSLJYWAIUPYINO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|