C25H40O4Si — CID 11984385
[(1S,4R,5R)-8-[tert-butyl(dimethyl)silyl]oxy-4-formyl-7-[(Z)-oct-2-enyl]-1-bicyclo[3.2.1]octa-2,6-dienyl] acetate (PubChem CID 11984385) has the molecular formula C25H40O4Si and a molecular weight of 432.68 g/mol. Its IUPAC name is [(1S,4R,5R)-8-[tert-butyl(dimethyl)silyl]oxy-4-formyl-7-[(Z)-oct-2-enyl]-1-bicyclo[3.2.1]octa-2,6-dienyl] acetate.
| Compound Name | [(1S,4R,5R)-8-[tert-butyl(dimethyl)silyl]oxy-4-formyl-7-[(Z)-oct-2-enyl]-1-bicyclo[3.2.1]octa-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 11984385 |
| Molecular Formula | C25H40O4Si |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | [(1S,4R,5R)-8-[tert-butyl(dimethyl)silyl]oxy-4-formyl-7-[(Z)-oct-2-enyl]-1-bicyclo[3.2.1]octa-2,6-dienyl] acetate |
| SMILES | CCCCC/C=C\CC1=C[C@H]2C(O[Si](C)(C)C(C)(C)C)[C@]1(OC(C)=O)C=C[C@H]2C=O |
| InChI | InChI=1S/C25H40O4Si/c1-8-9-10-11-12-13-14-21-17-22-20(18-26)15-16-25(21,28-19(2)27)23(22)29-30(6,7)24(3,4)5/h12-13,15-18,20,22-23H,8-11,14H2,1-7H3/b13-12-/t20-,22+,23?,25-/m0/s1 |
| InChIKey | PTZJNRDTIDTXFD-DJMXWPHVSA-N |
| XLogP | 6.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|