C27H48O5Si — CID 11248641
tert-butyl (E,6R)-8-[(2S,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-(2-oxoethyl)-3,6-dihydro-2H-pyran-2-yl]-6-methylnon-7-enoate (PubChem CID 11248641) has the molecular formula C27H48O5Si and a molecular weight of 480.76 g/mol. Its IUPAC name is tert-butyl (E,6R)-8-[(2S,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-(2-oxoethyl)-3,6-dihydro-2H-pyran-2-yl]-6-methylnon-7-enoate.
| Compound Name | tert-butyl (E,6R)-8-[(2S,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-(2-oxoethyl)-3,6-dihydro-2H-pyran-2-yl]-6-methylnon-7-enoate |
|---|---|
| PubChem CID | 11248641 |
| Molecular Formula | C27H48O5Si |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | tert-butyl (E,6R)-8-[(2S,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-(2-oxoethyl)-3,6-dihydro-2H-pyran-2-yl]-6-methylnon-7-enoate |
| SMILES | C/C(=C\[C@H](C)CCCCC(=O)OC(C)(C)C)[C@@H]1O[C@@H](CC=O)C=C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48O5Si/c1-20(13-11-12-14-24(29)31-26(3,4)5)19-21(2)25-23(16-15-22(30-25)17-18-28)32-33(9,10)27(6,7)8/h15-16,18-20,22-23,25H,11-14,17H2,1-10H3/b21-19+/t20-,22-,23-,25+/m1/s1 |
| InChIKey | DDNXLCLBZXZZHR-GMXYRYMTSA-N |
| XLogP | 6.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|