C17H34O3Si2 — CID 135020587
2-[(1S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilyloxycyclohex-2-en-1-yl]acetaldehyde (PubChem CID 135020587) has the molecular formula C17H34O3Si2 and a molecular weight of 342.63 g/mol. Its IUPAC name is 2-[(1S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilyloxycyclohex-2-en-1-yl]acetaldehyde.
| Compound Name | 2-[(1S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilyloxycyclohex-2-en-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 135020587 |
| Molecular Formula | C17H34O3Si2 |
| Molecular Weight | 342.63 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 2-[(1S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilyloxycyclohex-2-en-1-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC=C[C@]1(CC=O)O[Si](C)(C)C |
| InChI | InChI=1S/C17H34O3Si2/c1-16(2,3)22(7,8)19-15-11-9-10-12-17(15,13-14-18)20-21(4,5)6/h10,12,14-15H,9,11,13H2,1-8H3/t15-,17+/m0/s1 |
| InChIKey | AWQJPNRHGRNEEM-DOTOQJQBSA-N |
| XLogP | 4.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|